C34H43N2O3+ — CID 123314848
2,2-dimethylpropane;2-(3-piperidin-1-ium-1-ylidene-6-piperidin-1-ylxanthen-9-yl)benzene-1,3-diol (PubChem CID 123314848) has the molecular formula C34H43N2O3+ and a molecular weight of 527.73 g/mol. Its IUPAC name is 2,2-dimethylpropane;2-(3-piperidin-1-ium-1-ylidene-6-piperidin-1-ylxanthen-9-yl)benzene-1,3-diol.
| Compound Name | 2,2-dimethylpropane;2-(3-piperidin-1-ium-1-ylidene-6-piperidin-1-ylxanthen-9-yl)benzene-1,3-diol |
|---|---|
| PubChem CID | 123314848 |
| Molecular Formula | C34H43N2O3+ |
| Molecular Weight | 527.73 g/mol |
| Exact Mass | 527.33 |
| IUPAC Name | 2,2-dimethylpropane;2-(3-piperidin-1-ium-1-ylidene-6-piperidin-1-ylxanthen-9-yl)benzene-1,3-diol |
| SMILES | CC(C)(C)C.Oc1cccc(O)c1-c1c2ccc(=[N+]3CCCCC3)cc-2oc2cc(N3CCCCC3)ccc12 |
| InChI | InChI=1S/C29H30N2O3.C5H12/c32-24-8-7-9-25(33)29(24)28-22-12-10-20(30-14-3-1-4-15-30)18-26(22)34-27-19-21(11-13-23(27)28)31-16-5-2-6-17-31;1-5(2,3)4/h7-13,18-19H,1-6,14-17H2,(H,32,33);1-4H3/p+1 |
| InChIKey | MYJWBEDAEYOAKU-UHFFFAOYSA-O |
| XLogP | 7.61 |
| TPSA | 59.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.73 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|