C29H30N2O4S — CID 140761020
2-(3-piperidin-1-ium-1-ylidene-6-piperidin-1-ylxanthen-9-yl)benzenesulfonate (PubChem CID 140761020) has the molecular formula C29H30N2O4S and a molecular weight of 502.64 g/mol. Its IUPAC name is 2-(3-piperidin-1-ium-1-ylidene-6-piperidin-1-ylxanthen-9-yl)benzenesulfonate.
| Compound Name | 2-(3-piperidin-1-ium-1-ylidene-6-piperidin-1-ylxanthen-9-yl)benzenesulfonate |
|---|---|
| PubChem CID | 140761020 |
| Molecular Formula | C29H30N2O4S |
| Molecular Weight | 502.64 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | 2-(3-piperidin-1-ium-1-ylidene-6-piperidin-1-ylxanthen-9-yl)benzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccccc1-c1c2ccc(=[N+]3CCCCC3)cc-2oc2cc(N3CCCCC3)ccc12 |
| InChI | InChI=1S/C29H30N2O4S/c32-36(33,34)28-10-4-3-9-25(28)29-23-13-11-21(30-15-5-1-6-16-30)19-26(23)35-27-20-22(12-14-24(27)29)31-17-7-2-8-18-31/h3-4,9-14,19-20H,1-2,5-8,15-18H2 |
| InChIKey | IDJLYHDIPVPWCZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 76.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.64 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|