C19H15N3O4S — CID 59576217
2-[(6E)-3-amino-6-aminoazaniumylidenexanthen-9-yl]benzenesulfonate (PubChem CID 59576217) has the molecular formula C19H15N3O4S and a molecular weight of 381.41 g/mol. Its IUPAC name is 2-[(6E)-3-amino-6-aminoazaniumylidenexanthen-9-yl]benzenesulfonate.
| Compound Name | 2-[(6E)-3-amino-6-aminoazaniumylidenexanthen-9-yl]benzenesulfonate |
|---|---|
| PubChem CID | 59576217 |
| Molecular Formula | C19H15N3O4S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 2-[(6E)-3-amino-6-aminoazaniumylidenexanthen-9-yl]benzenesulfonate |
| SMILES | N/[NH+]=c1\ccc2c(-c3ccccc3S(=O)(=O)[O-])c3ccc(N)cc3oc-2c1 |
| InChI | InChI=1S/C19H15N3O4S/c20-11-5-7-13-16(9-11)26-17-10-12(22-21)6-8-14(17)19(13)15-3-1-2-4-18(15)27(23,24)25/h1-10H,20-21H2,(H,23,24,25)/b22-12+ |
| InChIKey | NYANYUALCIGJER-WSDLNYQXSA-N |
| XLogP | 0.55 |
| TPSA | 136.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|