C26H25N2O2S2+ — CID 162451284
(Z)-(6-amino-9-phenylxanthen-3-ylidene)-(2-methyl-3-oxopentyl)sulfanylcarbothioylazanium (PubChem CID 162451284) has the molecular formula C26H25N2O2S2+ and a molecular weight of 461.63 g/mol. Its IUPAC name is (Z)-(6-amino-9-phenylxanthen-3-ylidene)-(2-methyl-3-oxopentyl)sulfanylcarbothioylazanium.
| Compound Name | (Z)-(6-amino-9-phenylxanthen-3-ylidene)-(2-methyl-3-oxopentyl)sulfanylcarbothioylazanium |
|---|---|
| PubChem CID | 162451284 |
| Molecular Formula | C26H25N2O2S2+ |
| Molecular Weight | 461.63 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | (Z)-(6-amino-9-phenylxanthen-3-ylidene)-(2-methyl-3-oxopentyl)sulfanylcarbothioylazanium |
| SMILES | CCC(=O)C(C)CSC(=S)/[NH+]=c1/ccc2c(-c3ccccc3)c3ccc(N)cc3oc-2c1 |
| InChI | InChI=1S/C26H24N2O2S2/c1-3-22(29)16(2)15-32-26(31)28-19-10-12-21-24(14-19)30-23-13-18(27)9-11-20(23)25(21)17-7-5-4-6-8-17/h4-14,16H,3,15,27H2,1-2H3/p+1/b28-19- |
| InChIKey | BXZYJOPNZYIVHE-USHMODERSA-O |
| XLogP | 4.40 |
| TPSA | 70.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.63 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|