C25H23N2O3S+ — CID 162451291
(Z)-(6-amino-9-phenylxanthen-3-ylidene)-(3-oxopentoxycarbothioyl)azanium (PubChem CID 162451291) has the molecular formula C25H23N2O3S+ and a molecular weight of 431.54 g/mol. Its IUPAC name is (Z)-(6-amino-9-phenylxanthen-3-ylidene)-(3-oxopentoxycarbothioyl)azanium.
| Compound Name | (Z)-(6-amino-9-phenylxanthen-3-ylidene)-(3-oxopentoxycarbothioyl)azanium |
|---|---|
| PubChem CID | 162451291 |
| Molecular Formula | C25H23N2O3S+ |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | (Z)-(6-amino-9-phenylxanthen-3-ylidene)-(3-oxopentoxycarbothioyl)azanium |
| SMILES | CCC(=O)CCOC(=S)/[NH+]=c1/ccc2c(-c3ccccc3)c3ccc(N)cc3oc-2c1 |
| InChI | InChI=1S/C25H22N2O3S/c1-2-19(28)12-13-29-25(31)27-18-9-11-21-23(15-18)30-22-14-17(26)8-10-20(22)24(21)16-6-4-3-5-7-16/h3-11,14-15H,2,12-13,26H2,1H3/p+1/b27-18- |
| InChIKey | LXMLFNUYJKZNOU-IMRQLAEWSA-O |
| XLogP | 3.44 |
| TPSA | 79.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|