About S-(2-methyl-3-oxopentyl) N-(6-amino-9-phenylxanthen-3-ylidene)carbamothioate
S-(2-methyl-3-oxopentyl) N-(6-amino-9-phenylxanthen-3-ylidene)carbamothioate (PubChem CID 158673845) has the molecular formula C26H24N2O3S
and a molecular weight of 444.56 g/mol. Its IUPAC name is S-(2-methyl-3-oxopentyl) N-(6-amino-9-phenylxanthen-3-ylidene)carbamothioate.
Molecular Properties
| Compound Name | S-(2-methyl-3-oxopentyl) N-(6-amino-9-phenylxanthen-3-ylidene)carbamothioate |
| PubChem CID | 158673845 |
| Molecular Formula | C26H24N2O3S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | S-(2-methyl-3-oxopentyl) N-(6-amino-9-phenylxanthen-3-ylidene)carbamothioate |
| SMILES | CCC(=O)C(C)CSC(=O)N=c1ccc2c(-c3ccccc3)c3ccc(N)cc3oc-2c1 |
| InChI | InChI=1S/C26H24N2O3S/c1-3-22(29)16(2)15-32-26(30)28-19-10-12-21-24(14-19)31-23-13-18(27)9-11-20(23)25(21)17-7-5-4-6-8-17/h4-14,16H,3,15,27H2,1-2H3 |
| InChIKey | QZMWRILCNZJUCU-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(2-methyl-3-oxopentyl) N-(6-amino-9-phenylxanthen-3-ylidene)carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(2-methyl-3-oxopentyl) N-(6-amino-9-phenylxanthen-3-ylidene)carbamothioate?
The IUPAC name of S-(2-methyl-3-oxopentyl) N-(6-amino-9-phenylxanthen-3-ylidene)carbamothioate (CID 158673845) is S-(2-methyl-3-oxopentyl) N-(6-amino-9-phenylxanthen-3-ylidene)carbamothioate.
What is the SMILES notation for S-(2-methyl-3-oxopentyl) N-(6-amino-9-phenylxanthen-3-ylidene)carbamothioate?
The canonical SMILES for S-(2-methyl-3-oxopentyl) N-(6-amino-9-phenylxanthen-3-ylidene)carbamothioate is CCC(=O)C(C)CSC(=O)N=c1ccc2c(-c3ccccc3)c3ccc(N)cc3oc-2c1.
What is the InChIKey of S-(2-methyl-3-oxopentyl) N-(6-amino-9-phenylxanthen-3-ylidene)carbamothioate?
The InChIKey is QZMWRILCNZJUCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24N2O3S/c1-3-22(29)16(2)15-32-26(30)28-19-10-12-21-24(14-19)31-23-13-18(27)9-11-20(23)25(21)17-7-5-4-6-8-17/h4-14,16H,3,15,27H2,1-2H3.
What are the key properties of S-(2-methyl-3-oxopentyl) N-(6-amino-9-phenylxanthen-3-ylidene)carbamothioate?
S-(2-methyl-3-oxopentyl) N-(6-amino-9-phenylxanthen-3-ylidene)carbamothioate has a molecular weight of 444.56 g/mol, XLogP of 6.16, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-(2-methyl-3-oxopentyl) N-(6-amino-9-phenylxanthen-3-ylidene)carbamothioate is sourced from PubChem (CID 158673845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).