C27H22N2O9 — CID 171382465
3-[3-(ethoxycarbonylamino)-6-ethoxycarbonyliminoxanthen-9-yl]phthalic acid (PubChem CID 171382465) has the molecular formula C27H22N2O9 and a molecular weight of 518.48 g/mol. Its IUPAC name is 3-[3-(ethoxycarbonylamino)-6-ethoxycarbonyliminoxanthen-9-yl]phthalic acid.
| Compound Name | 3-[3-(ethoxycarbonylamino)-6-ethoxycarbonyliminoxanthen-9-yl]phthalic acid |
|---|---|
| PubChem CID | 171382465 |
| Molecular Formula | C27H22N2O9 |
| Molecular Weight | 518.48 g/mol |
| Exact Mass | 518.13 |
| IUPAC Name | 3-[3-(ethoxycarbonylamino)-6-ethoxycarbonyliminoxanthen-9-yl]phthalic acid |
| SMILES | CCOC(=O)N=c1ccc2c(-c3cccc(C(=O)O)c3C(=O)O)c3ccc(NC(=O)OCC)cc3oc-2c1 |
| InChI | InChI=1S/C27H22N2O9/c1-3-36-26(34)28-14-8-10-16-20(12-14)38-21-13-15(29-27(35)37-4-2)9-11-17(21)22(16)18-6-5-7-19(24(30)31)23(18)25(32)33/h5-13H,3-4H2,1-2H3,(H,28,34)(H,30,31)(H,32,33) |
| InChIKey | ZCLPJACMDDWHTI-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 164.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.48 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|