C37H41N3O10 — CID 167313121
4-(5-carboxypentylcarbamoyl)-2-[(6E)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[(2-methylpropan-2-yl)oxycarbonylimino]xanthen-9-yl]benzoic acid (PubChem CID 167313121) has the molecular formula C37H41N3O10 and a molecular weight of 687.75 g/mol. Its IUPAC name is 4-(5-carboxypentylcarbamoyl)-2-[(6E)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[(2-methylpropan-2-yl)oxycarbonylimino]xanthen-9-yl]benzoic acid.
| Compound Name | 4-(5-carboxypentylcarbamoyl)-2-[(6E)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[(2-methylpropan-2-yl)oxycarbonylimino]xanthen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 167313121 |
| Molecular Formula | C37H41N3O10 |
| Molecular Weight | 687.75 g/mol |
| Exact Mass | 687.28 |
| IUPAC Name | 4-(5-carboxypentylcarbamoyl)-2-[(6E)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[(2-methylpropan-2-yl)oxycarbonylimino]xanthen-9-yl]benzoic acid |
| SMILES | CC(C)(C)OC(=O)/N=c1\ccc2c(-c3cc(C(=O)NCCCCCC(=O)O)ccc3C(=O)O)c3ccc(NC(=O)OC(C)(C)C)cc3oc-2c1 |
| InChI | InChI=1S/C37H41N3O10/c1-36(2,3)49-34(46)39-22-12-15-25-28(19-22)48-29-20-23(40-35(47)50-37(4,5)6)13-16-26(29)31(25)27-18-21(11-14-24(27)33(44)45)32(43)38-17-9-7-8-10-30(41)42/h11-16,18-20H,7-10,17H2,1-6H3,(H,38,43)(H,39,46)(H,41,42)(H,44,45)/b40-23+ |
| InChIKey | JWZSADCKHQFLHL-ZXTCRCEHSA-N |
| XLogP | 7.46 |
| TPSA | 193.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.75 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|