C36H40N4O10S — CID 24755965
5-[[6-[carboxymethyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]-6-oxohexyl]carbamothioylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 24755965) has the molecular formula C36H40N4O10S and a molecular weight of 720.80 g/mol. Its IUPAC name is 5-[[6-[carboxymethyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]-6-oxohexyl]carbamothioylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 5-[[6-[carboxymethyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]-6-oxohexyl]carbamothioylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 24755965 |
| Molecular Formula | C36H40N4O10S |
| Molecular Weight | 720.80 g/mol |
| Exact Mass | 720.25 |
| IUPAC Name | 5-[[6-[carboxymethyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]-6-oxohexyl]carbamothioylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | CC(C)(C)OC(=O)NCCN(CC(=O)O)C(=O)CCCCCNC(=S)Nc1ccc(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c(C(=O)O)c1 |
| InChI | InChI=1S/C36H40N4O10S/c1-36(2,3)50-35(48)38-15-16-40(20-31(44)45)30(43)7-5-4-6-14-37-34(51)39-21-8-11-24(27(17-21)33(46)47)32-25-12-9-22(41)18-28(25)49-29-19-23(42)10-13-26(29)32/h8-13,17-19,41H,4-7,14-16,20H2,1-3H3,(H,38,48)(H,44,45)(H,46,47)(H2,37,39,51) |
| InChIKey | GJJKRUGVXQOIRL-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 207.74 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.80 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|