C34H48N3O4S2+ — CID 162090847
[6-(diethylamino)-9-phenylxanthen-3-ylidene]-diethylazanium;methanamine;4-sulfanylidenehexane-1-sulfonic acid (PubChem CID 162090847) has the molecular formula C34H48N3O4S2+ and a molecular weight of 626.91 g/mol. Its IUPAC name is [6-(diethylamino)-9-phenylxanthen-3-ylidene]-diethylazanium;methanamine;4-sulfanylidenehexane-1-sulfonic acid.
| Compound Name | [6-(diethylamino)-9-phenylxanthen-3-ylidene]-diethylazanium;methanamine;4-sulfanylidenehexane-1-sulfonic acid |
|---|---|
| PubChem CID | 162090847 |
| Molecular Formula | C34H48N3O4S2+ |
| Molecular Weight | 626.91 g/mol |
| Exact Mass | 626.31 |
| IUPAC Name | [6-(diethylamino)-9-phenylxanthen-3-ylidene]-diethylazanium;methanamine;4-sulfanylidenehexane-1-sulfonic acid |
| SMILES | CCC(=S)CCCS(=O)(=O)O.CCN(CC)c1ccc2c(-c3ccccc3)c3ccc(=[N+](CC)CC)cc-3oc2c1.CN |
| InChI | InChI=1S/C27H31N2O.C6H12O3S2.CH5N/c1-5-28(6-2)21-14-16-23-25(18-21)30-26-19-22(29(7-3)8-4)15-17-24(26)27(23)20-12-10-9-11-13-20;1-2-6(10)4-3-5-11(7,8)9;1-2/h9-19H,5-8H2,1-4H3;2-5H2,1H3,(H,7,8,9);2H2,1H3/q+1;; |
| InChIKey | ZDOXCZHOPBUMLT-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 99.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.91 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|