C32H47N3O4PS+ — CID 160946674
[6-(diethylamino)-9-phenylxanthen-3-ylidene]-diethylazanium;methanamine;3-methylsulfanylpropylphosphonic acid (PubChem CID 160946674) has the molecular formula C32H47N3O4PS+ and a molecular weight of 600.79 g/mol. Its IUPAC name is [6-(diethylamino)-9-phenylxanthen-3-ylidene]-diethylazanium;methanamine;3-methylsulfanylpropylphosphonic acid.
| Compound Name | [6-(diethylamino)-9-phenylxanthen-3-ylidene]-diethylazanium;methanamine;3-methylsulfanylpropylphosphonic acid |
|---|---|
| PubChem CID | 160946674 |
| Molecular Formula | C32H47N3O4PS+ |
| Molecular Weight | 600.79 g/mol |
| Exact Mass | 600.30 |
| IUPAC Name | [6-(diethylamino)-9-phenylxanthen-3-ylidene]-diethylazanium;methanamine;3-methylsulfanylpropylphosphonic acid |
| SMILES | CCN(CC)c1ccc2c(-c3ccccc3)c3ccc(=[N+](CC)CC)cc-3oc2c1.CN.CSCCCP(=O)(O)O |
| InChI | InChI=1S/C27H31N2O.C4H11O3PS.CH5N/c1-5-28(6-2)21-14-16-23-25(18-21)30-26-19-22(29(7-3)8-4)15-17-24(26)27(23)20-12-10-9-11-13-20;1-9-4-2-3-8(5,6)7;1-2/h9-19H,5-8H2,1-4H3;2-4H2,1H3,(H2,5,6,7);2H2,1H3/q+1;; |
| InChIKey | SVFBVOGKLVQRFK-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 102.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.79 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|