C19H10Na2O6S — CID 53384586
disodium;2-(3-oxido-6-oxoxanthen-9-yl)benzenesulfonate (PubChem CID 53384586) has the molecular formula C19H10Na2O6S and a molecular weight of 412.33 g/mol. Its IUPAC name is disodium;2-(3-oxido-6-oxoxanthen-9-yl)benzenesulfonate.
| Compound Name | disodium;2-(3-oxido-6-oxoxanthen-9-yl)benzenesulfonate |
|---|---|
| PubChem CID | 53384586 |
| Molecular Formula | C19H10Na2O6S |
| Molecular Weight | 412.33 g/mol |
| Exact Mass | 412.00 |
| IUPAC Name | disodium;2-(3-oxido-6-oxoxanthen-9-yl)benzenesulfonate |
| SMILES | O=c1ccc2c(-c3ccccc3S(=O)(=O)[O-])c3ccc([O-])cc3oc-2c1.[Na+].[Na+] |
| InChI | InChI=1S/C19H12O6S.2Na/c20-11-5-7-13-16(9-11)25-17-10-12(21)6-8-14(17)19(13)15-3-1-2-4-18(15)26(22,23)24;;/h1-10,20H,(H,22,23,24);;/q;2*+1/p-2 |
| InChIKey | OWXUMLTXQGFZAP-UHFFFAOYSA-L |
| XLogP | -3.45 |
| TPSA | 110.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.33 |
| LogP ≤ 5 | -3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|