C20H16N2O5S — CID 59576177
2-[(3E)-3-aminoazaniumylidene-6-methoxyxanthen-9-yl]benzenesulfonate (PubChem CID 59576177) has the molecular formula C20H16N2O5S and a molecular weight of 396.42 g/mol. Its IUPAC name is 2-[(3E)-3-aminoazaniumylidene-6-methoxyxanthen-9-yl]benzenesulfonate.
| Compound Name | 2-[(3E)-3-aminoazaniumylidene-6-methoxyxanthen-9-yl]benzenesulfonate |
|---|---|
| PubChem CID | 59576177 |
| Molecular Formula | C20H16N2O5S |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 2-[(3E)-3-aminoazaniumylidene-6-methoxyxanthen-9-yl]benzenesulfonate |
| SMILES | COc1ccc2c(-c3ccccc3S(=O)(=O)[O-])c3cc/c(=[NH+]\N)cc-3oc2c1 |
| InChI | InChI=1S/C20H16N2O5S/c1-26-13-7-9-15-18(11-13)27-17-10-12(22-21)6-8-14(17)20(15)16-4-2-3-5-19(16)28(23,24)25/h2-11H,21H2,1H3,(H,23,24,25)/b22-12+ |
| InChIKey | XJIBYECCGLZVMP-WSDLNYQXSA-N |
| XLogP | 0.97 |
| TPSA | 119.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|