C25H19N2O6S2+ — CID 91083602
[9-(2-sulfamoylphenyl)xanthen-3-ylidene]-(2-sulfophenyl)azanium (PubChem CID 91083602) has the molecular formula C25H19N2O6S2+ and a molecular weight of 507.57 g/mol. Its IUPAC name is [9-(2-sulfamoylphenyl)xanthen-3-ylidene]-(2-sulfophenyl)azanium.
| Compound Name | [9-(2-sulfamoylphenyl)xanthen-3-ylidene]-(2-sulfophenyl)azanium |
|---|---|
| PubChem CID | 91083602 |
| Molecular Formula | C25H19N2O6S2+ |
| Molecular Weight | 507.57 g/mol |
| Exact Mass | 507.07 |
| IUPAC Name | [9-(2-sulfamoylphenyl)xanthen-3-ylidene]-(2-sulfophenyl)azanium |
| SMILES | NS(=O)(=O)c1ccccc1-c1c2cc/c(=[NH+]\c3ccccc3S(=O)(=O)O)cc-2oc2ccccc12 |
| InChI | InChI=1S/C25H18N2O6S2/c26-34(28,29)23-11-5-2-8-19(23)25-17-7-1-4-10-21(17)33-22-15-16(13-14-18(22)25)27-20-9-3-6-12-24(20)35(30,31)32/h1-15H,(H2,26,28,29)(H,30,31,32)/p+1/b27-16+ |
| InChIKey | OQEUMGUTXYGIQX-JVWAILMASA-O |
| XLogP | 2.41 |
| TPSA | 141.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.57 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|