C47H30N2O8S — CID 118085164
2-[3-[(4-methyl-9-oxoxanthen-1-yl)amino]-6-(4-methyl-9-oxoxanthen-1-yl)iminoxanthen-9-yl]benzenesulfonic acid (PubChem CID 118085164) has the molecular formula C47H30N2O8S and a molecular weight of 782.83 g/mol. Its IUPAC name is 2-[3-[(4-methyl-9-oxoxanthen-1-yl)amino]-6-(4-methyl-9-oxoxanthen-1-yl)iminoxanthen-9-yl]benzenesulfonic acid.
| Compound Name | 2-[3-[(4-methyl-9-oxoxanthen-1-yl)amino]-6-(4-methyl-9-oxoxanthen-1-yl)iminoxanthen-9-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 118085164 |
| Molecular Formula | C47H30N2O8S |
| Molecular Weight | 782.83 g/mol |
| Exact Mass | 782.17 |
| IUPAC Name | 2-[3-[(4-methyl-9-oxoxanthen-1-yl)amino]-6-(4-methyl-9-oxoxanthen-1-yl)iminoxanthen-9-yl]benzenesulfonic acid |
| SMILES | Cc1ccc(/N=c2\ccc3c(-c4ccccc4S(=O)(=O)O)c4ccc(Nc5ccc(C)c6oc7ccccc7c(=O)c56)cc4oc-3c2)c2c(=O)c3ccccc3oc12 |
| InChI | InChI=1S/C47H30N2O8S/c1-25-15-21-34(42-44(50)31-9-3-6-12-36(31)56-46(25)42)48-27-17-19-29-38(23-27)55-39-24-28(18-20-30(39)41(29)33-11-5-8-14-40(33)58(52,53)54)49-35-22-16-26(2)47-43(35)45(51)32-10-4-7-13-37(32)57-47/h3-24,48H,1-2H3,(H,52,53,54)/b49-28+ |
| InChIKey | WKXRDZPUJONSBO-GBIUOOPFSA-N |
| XLogP | 10.56 |
| TPSA | 152.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.83 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|