C35H31N2O7S2+ — CID 140630516
[6-(2,6-dimethylanilino)-2-sulfo-9-(2-sulfophenyl)xanthen-3-ylidene]-(2,6-dimethylphenyl)azanium (PubChem CID 140630516) has the molecular formula C35H31N2O7S2+ and a molecular weight of 655.77 g/mol. Its IUPAC name is [6-(2,6-dimethylanilino)-2-sulfo-9-(2-sulfophenyl)xanthen-3-ylidene]-(2,6-dimethylphenyl)azanium.
| Compound Name | [6-(2,6-dimethylanilino)-2-sulfo-9-(2-sulfophenyl)xanthen-3-ylidene]-(2,6-dimethylphenyl)azanium |
|---|---|
| PubChem CID | 140630516 |
| Molecular Formula | C35H31N2O7S2+ |
| Molecular Weight | 655.77 g/mol |
| Exact Mass | 655.16 |
| IUPAC Name | [6-(2,6-dimethylanilino)-2-sulfo-9-(2-sulfophenyl)xanthen-3-ylidene]-(2,6-dimethylphenyl)azanium |
| SMILES | Cc1cccc(C)c1Nc1ccc2c(-c3ccccc3S(=O)(=O)O)c3cc(S(=O)(=O)O)/c(=[NH+]/c4c(C)cccc4C)cc-3oc2c1 |
| InChI | InChI=1S/C35H30N2O7S2/c1-20-9-7-10-21(2)34(20)36-24-15-16-25-29(17-24)44-30-19-28(37-35-22(3)11-8-12-23(35)4)32(46(41,42)43)18-27(30)33(25)26-13-5-6-14-31(26)45(38,39)40/h5-19,36H,1-4H3,(H,38,39,40)(H,41,42,43)/p+1/b37-28+ |
| InChIKey | AJXZZBUKZBOZJX-PNFNHJRFSA-O |
| XLogP | 5.99 |
| TPSA | 147.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.77 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|