C43H46N3O5S+ — CID 140711201
[6-(2,6-dimethylanilino)-9-[2-[2-(2,2-dimethylbutanoyloxy)ethylsulfamoyl]phenyl]xanthen-3-ylidene]-(2,6-dimethylphenyl)azanium (PubChem CID 140711201) has the molecular formula C43H46N3O5S+ and a molecular weight of 716.92 g/mol. Its IUPAC name is [6-(2,6-dimethylanilino)-9-[2-[2-(2,2-dimethylbutanoyloxy)ethylsulfamoyl]phenyl]xanthen-3-ylidene]-(2,6-dimethylphenyl)azanium.
| Compound Name | [6-(2,6-dimethylanilino)-9-[2-[2-(2,2-dimethylbutanoyloxy)ethylsulfamoyl]phenyl]xanthen-3-ylidene]-(2,6-dimethylphenyl)azanium |
|---|---|
| PubChem CID | 140711201 |
| Molecular Formula | C43H46N3O5S+ |
| Molecular Weight | 716.92 g/mol |
| Exact Mass | 716.32 |
| IUPAC Name | [6-(2,6-dimethylanilino)-9-[2-[2-(2,2-dimethylbutanoyloxy)ethylsulfamoyl]phenyl]xanthen-3-ylidene]-(2,6-dimethylphenyl)azanium |
| SMILES | CCC(C)(C)C(=O)OCCNS(=O)(=O)c1ccccc1-c1c2cc/c(=[NH+]\c3c(C)cccc3C)cc-2oc2cc(Nc3c(C)cccc3C)ccc12 |
| InChI | InChI=1S/C43H45N3O5S/c1-8-43(6,7)42(47)50-24-23-44-52(48,49)38-18-10-9-17-35(38)39-33-21-19-31(45-40-27(2)13-11-14-28(40)3)25-36(33)51-37-26-32(20-22-34(37)39)46-41-29(4)15-12-16-30(41)5/h9-22,25-26,44-45H,8,23-24H2,1-7H3/p+1/b46-32+ |
| InChIKey | PNYPPELNGFPURZ-LGDHCNBZSA-O |
| XLogP | 7.75 |
| TPSA | 111.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.92 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|