C31H21ClN2O3S — CID 122419756
2-(3-anilino-6-phenyliminoxanthen-9-yl)benzenesulfonyl chloride (PubChem CID 122419756) has the molecular formula C31H21ClN2O3S and a molecular weight of 537.04 g/mol. Its IUPAC name is 2-(3-anilino-6-phenyliminoxanthen-9-yl)benzenesulfonyl chloride.
| Compound Name | 2-(3-anilino-6-phenyliminoxanthen-9-yl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 122419756 |
| Molecular Formula | C31H21ClN2O3S |
| Molecular Weight | 537.04 g/mol |
| Exact Mass | 536.10 |
| IUPAC Name | 2-(3-anilino-6-phenyliminoxanthen-9-yl)benzenesulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1ccccc1-c1c2cc/c(=N\c3ccccc3)cc-2oc2cc(Nc3ccccc3)ccc12 |
| InChI | InChI=1S/C31H21ClN2O3S/c32-38(35,36)30-14-8-7-13-27(30)31-25-17-15-23(33-21-9-3-1-4-10-21)19-28(25)37-29-20-24(16-18-26(29)31)34-22-11-5-2-6-12-22/h1-20,33H/b34-24+ |
| InChIKey | GYNOJIZLJIPCPK-JGRMKTMXSA-N |
| XLogP | 8.11 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.04 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|