C33H22N2O8S — CID 147201930
4-[[6-(4-carboxyphenyl)imino-9-(2-sulfophenyl)xanthen-3-yl]amino]benzoic acid (PubChem CID 147201930) has the molecular formula C33H22N2O8S and a molecular weight of 606.61 g/mol. Its IUPAC name is 4-[[6-(4-carboxyphenyl)imino-9-(2-sulfophenyl)xanthen-3-yl]amino]benzoic acid.
| Compound Name | 4-[[6-(4-carboxyphenyl)imino-9-(2-sulfophenyl)xanthen-3-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 147201930 |
| Molecular Formula | C33H22N2O8S |
| Molecular Weight | 606.61 g/mol |
| Exact Mass | 606.11 |
| IUPAC Name | 4-[[6-(4-carboxyphenyl)imino-9-(2-sulfophenyl)xanthen-3-yl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(/N=c2\ccc3c(-c4ccccc4S(=O)(=O)O)c4ccc(Nc5ccc(C(=O)O)cc5)cc4oc-3c2)cc1 |
| InChI | InChI=1S/C33H22N2O8S/c36-32(37)19-5-9-21(10-6-19)34-23-13-15-25-28(17-23)43-29-18-24(35-22-11-7-20(8-12-22)33(38)39)14-16-26(29)31(25)27-3-1-2-4-30(27)44(40,41)42/h1-18,34H,(H,36,37)(H,38,39)(H,40,41,42)/b35-24+ |
| InChIKey | CDMOZSZASHGFGQ-JWHWKPFMSA-N |
| XLogP | 6.82 |
| TPSA | 166.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.61 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|