C31H22N2O10S3 — CID 21340328
2-[3-(4-sulfophenyl)imino-6-[4-(trioxidanylsulfanyl)anilino]xanthen-9-yl]benzenesulfonic acid (PubChem CID 21340328) has the molecular formula C31H22N2O10S3 and a molecular weight of 678.72 g/mol. Its IUPAC name is 2-[3-(4-sulfophenyl)imino-6-[4-(trioxidanylsulfanyl)anilino]xanthen-9-yl]benzenesulfonic acid.
| Compound Name | 2-[3-(4-sulfophenyl)imino-6-[4-(trioxidanylsulfanyl)anilino]xanthen-9-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 21340328 |
| Molecular Formula | C31H22N2O10S3 |
| Molecular Weight | 678.72 g/mol |
| Exact Mass | 678.04 |
| IUPAC Name | 2-[3-(4-sulfophenyl)imino-6-[4-(trioxidanylsulfanyl)anilino]xanthen-9-yl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(/N=c2\ccc3c(-c4ccccc4S(=O)(=O)O)c4ccc(Nc5ccc(SOOO)cc5)cc4oc-3c2)cc1 |
| InChI | InChI=1S/C31H22N2O10S3/c34-42-43-44-23-11-5-19(6-12-23)32-21-9-15-25-28(17-21)41-29-18-22(33-20-7-13-24(14-8-20)45(35,36)37)10-16-26(29)31(25)27-3-1-2-4-30(27)46(38,39)40/h1-18,32,34H,(H,35,36,37)(H,38,39,40)/b33-22+ |
| InChIKey | DZCQIXKETVNSBX-STKMKYKTSA-N |
| XLogP | 7.10 |
| TPSA | 184.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.72 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|