C39H36ClN3O5S — CID 87350160
[9-[2-(4-carboxypiperidin-1-yl)sulfonylphenyl]-6-(2-methylanilino)xanthen-3-ylidene]-(2-methylphenyl)azanium chloride (PubChem CID 87350160) has the molecular formula C39H36ClN3O5S and a molecular weight of 694.25 g/mol. Its IUPAC name is [9-[2-(4-carboxypiperidin-1-yl)sulfonylphenyl]-6-(2-methylanilino)xanthen-3-ylidene]-(2-methylphenyl)azanium chloride.
| Compound Name | [9-[2-(4-carboxypiperidin-1-yl)sulfonylphenyl]-6-(2-methylanilino)xanthen-3-ylidene]-(2-methylphenyl)azanium chloride |
|---|---|
| PubChem CID | 87350160 |
| Molecular Formula | C39H36ClN3O5S |
| Molecular Weight | 694.25 g/mol |
| Exact Mass | 693.21 |
| IUPAC Name | [9-[2-(4-carboxypiperidin-1-yl)sulfonylphenyl]-6-(2-methylanilino)xanthen-3-ylidene]-(2-methylphenyl)azanium chloride |
| SMILES | Cc1ccccc1Nc1ccc2c(-c3ccccc3S(=O)(=O)N3CCC(C(=O)O)CC3)c3cc/c(=[NH+]\c4ccccc4C)cc-3oc2c1.[Cl-] |
| InChI | InChI=1S/C39H35N3O5S.ClH/c1-25-9-3-6-12-33(25)40-28-15-17-30-35(23-28)47-36-24-29(41-34-13-7-4-10-26(34)2)16-18-31(36)38(30)32-11-5-8-14-37(32)48(45,46)42-21-19-27(20-22-42)39(43)44;/h3-18,23-24,27,40H,19-22H2,1-2H3,(H,43,44);1H/b41-29+; |
| InChIKey | GSLPFUFKMRJWIW-RQYVBGCCSA-N |
| XLogP | 3.37 |
| TPSA | 113.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.25 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|