C41H38N5O4S+ — CID 145162416
1-[2-[3-(2,3-dihydroindol-1-ium-1-ylidene)-6-(2,3-dihydroindol-1-yl)xanthen-9-yl]phenyl]sulfonylpiperidine-4-carbohydrazide (PubChem CID 145162416) has the molecular formula C41H38N5O4S+ and a molecular weight of 696.85 g/mol. Its IUPAC name is 1-[2-[3-(2,3-dihydroindol-1-ium-1-ylidene)-6-(2,3-dihydroindol-1-yl)xanthen-9-yl]phenyl]sulfonylpiperidine-4-carbohydrazide.
| Compound Name | 1-[2-[3-(2,3-dihydroindol-1-ium-1-ylidene)-6-(2,3-dihydroindol-1-yl)xanthen-9-yl]phenyl]sulfonylpiperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 145162416 |
| Molecular Formula | C41H38N5O4S+ |
| Molecular Weight | 696.85 g/mol |
| Exact Mass | 696.26 |
| IUPAC Name | 1-[2-[3-(2,3-dihydroindol-1-ium-1-ylidene)-6-(2,3-dihydroindol-1-yl)xanthen-9-yl]phenyl]sulfonylpiperidine-4-carbohydrazide |
| SMILES | NNC(=O)C1CCN(S(=O)(=O)c2ccccc2-c2c3cc/c(=[N+]4/CCc5ccccc54)cc-3oc3cc(N4CCc5ccccc54)ccc23)CC1 |
| InChI | InChI=1S/C41H37N5O4S/c42-43-41(47)29-17-21-44(22-18-29)51(48,49)39-12-6-3-9-34(39)40-32-15-13-30(45-23-19-27-7-1-4-10-35(27)45)25-37(32)50-38-26-31(14-16-33(38)40)46-24-20-28-8-2-5-11-36(28)46/h1-16,25-26,29H,17-24,42H2/p+1 |
| InChIKey | LOCFSUGVTAMVRI-UHFFFAOYSA-O |
| XLogP | 5.95 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.85 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|