C36H30N3O3S+ — CID 58729511
2-[3-(2,3-dihydroindol-1-ium-1-ylidene)-6-(2,3-dihydroindol-1-yl)xanthen-9-yl]-N-methylbenzenesulfonamide (PubChem CID 58729511) has the molecular formula C36H30N3O3S+ and a molecular weight of 584.72 g/mol. Its IUPAC name is 2-[3-(2,3-dihydroindol-1-ium-1-ylidene)-6-(2,3-dihydroindol-1-yl)xanthen-9-yl]-N-methylbenzenesulfonamide.
| Compound Name | 2-[3-(2,3-dihydroindol-1-ium-1-ylidene)-6-(2,3-dihydroindol-1-yl)xanthen-9-yl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 58729511 |
| Molecular Formula | C36H30N3O3S+ |
| Molecular Weight | 584.72 g/mol |
| Exact Mass | 584.20 |
| IUPAC Name | 2-[3-(2,3-dihydroindol-1-ium-1-ylidene)-6-(2,3-dihydroindol-1-yl)xanthen-9-yl]-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccccc1-c1c2cc/c(=[N+]3/CCc4ccccc43)cc-2oc2cc(N3CCc4ccccc43)ccc12 |
| InChI | InChI=1S/C36H30N3O3S/c1-37-43(40,41)35-13-7-4-10-30(35)36-28-16-14-26(38-20-18-24-8-2-5-11-31(24)38)22-33(28)42-34-23-27(15-17-29(34)36)39-21-19-25-9-3-6-12-32(25)39/h2-17,22-23,37H,18-21H2,1H3/q+1 |
| InChIKey | BHPKKXFTAAIHRQ-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.72 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|