C24H20N3+ — CID 76846907
1-(2,3-dihydroindol-1-ium-1-ylidene)-3-(2,3-dihydroindol-1-yl)isoindole (PubChem CID 76846907) has the molecular formula C24H20N3+ and a molecular weight of 350.45 g/mol. Its IUPAC name is 1-(2,3-dihydroindol-1-ium-1-ylidene)-3-(2,3-dihydroindol-1-yl)isoindole.
| Compound Name | 1-(2,3-dihydroindol-1-ium-1-ylidene)-3-(2,3-dihydroindol-1-yl)isoindole |
|---|---|
| PubChem CID | 76846907 |
| Molecular Formula | C24H20N3+ |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 1-(2,3-dihydroindol-1-ium-1-ylidene)-3-(2,3-dihydroindol-1-yl)isoindole |
| SMILES | c1ccc2c(c1)CCN2C1=N/C(=[N+]2\CCc3ccccc32)c2ccccc21 |
| InChI | InChI=1S/C24H20N3/c1-5-11-21-17(7-1)13-15-26(21)23-19-9-3-4-10-20(19)24(25-23)27-16-14-18-8-2-6-12-22(18)27/h1-12H,13-16H2/q+1 |
| InChIKey | JIFIVVWTKMJDAX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 18.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|