About 1-(1H-imidazol-5-yl)-2,3-dihydroindole
1-(1H-imidazol-5-yl)-2,3-dihydroindole (PubChem CID 54328631) has the molecular formula C11H11N3
and a molecular weight of 185.23 g/mol. Its IUPAC name is 1-(1H-imidazol-5-yl)-2,3-dihydroindole.
Molecular Properties
| Compound Name | 1-(1H-imidazol-5-yl)-2,3-dihydroindole |
| PubChem CID | 54328631 |
| Molecular Formula | C11H11N3 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 1-(1H-imidazol-5-yl)-2,3-dihydroindole |
| SMILES | c1ccc2c(c1)CCN2c1cnc[nH]1 |
| InChI | InChI=1S/C11H11N3/c1-2-4-10-9(3-1)5-6-14(10)11-7-12-8-13-11/h1-4,7-8H,5-6H2,(H,12,13) |
| InChIKey | SWSZVDPZRGCFCT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1H-imidazol-5-yl)-2,3-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1H-imidazol-5-yl)-2,3-dihydroindole?
The IUPAC name of 1-(1H-imidazol-5-yl)-2,3-dihydroindole (CID 54328631) is 1-(1H-imidazol-5-yl)-2,3-dihydroindole.
What is the SMILES notation for 1-(1H-imidazol-5-yl)-2,3-dihydroindole?
The canonical SMILES for 1-(1H-imidazol-5-yl)-2,3-dihydroindole is c1ccc2c(c1)CCN2c1cnc[nH]1.
What is the InChIKey of 1-(1H-imidazol-5-yl)-2,3-dihydroindole?
The InChIKey is SWSZVDPZRGCFCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3/c1-2-4-10-9(3-1)5-6-14(10)11-7-12-8-13-11/h1-4,7-8H,5-6H2,(H,12,13).
What are the key properties of 1-(1H-imidazol-5-yl)-2,3-dihydroindole?
1-(1H-imidazol-5-yl)-2,3-dihydroindole has a molecular weight of 185.23 g/mol, XLogP of 2.10, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1H-imidazol-5-yl)-2,3-dihydroindole is sourced from PubChem (CID 54328631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).