C15H17ClN4O2 — CID 70202819
1-(2,3-dimethylphenyl)-4-(1H-imidazol-5-yl)piperazine-2,3-dione;hydrochloride (PubChem CID 70202819) has the molecular formula C15H17ClN4O2 and a molecular weight of 320.78 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-4-(1H-imidazol-5-yl)piperazine-2,3-dione;hydrochloride.
| Compound Name | 1-(2,3-dimethylphenyl)-4-(1H-imidazol-5-yl)piperazine-2,3-dione;hydrochloride |
|---|---|
| PubChem CID | 70202819 |
| Molecular Formula | C15H17ClN4O2 |
| Molecular Weight | 320.78 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-4-(1H-imidazol-5-yl)piperazine-2,3-dione;hydrochloride |
| SMILES | Cc1cccc(N2CCN(c3cnc[nH]3)C(=O)C2=O)c1C.Cl |
| InChI | InChI=1S/C15H16N4O2.ClH/c1-10-4-3-5-12(11(10)2)18-6-7-19(15(21)14(18)20)13-8-16-9-17-13;/h3-5,8-9H,6-7H2,1-2H3,(H,16,17);1H |
| InChIKey | LUMCPGHMLHWBQA-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.78 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|