C16H19N5O2 — CID 73276828
6-(2,3-dimethylphenyl)-4-methyl-4a,7,8,9a-tetrahydropurino[7,8-a]imidazole-1,3-dione (PubChem CID 73276828) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is 6-(2,3-dimethylphenyl)-4-methyl-4a,7,8,9a-tetrahydropurino[7,8-a]imidazole-1,3-dione.
| Compound Name | 6-(2,3-dimethylphenyl)-4-methyl-4a,7,8,9a-tetrahydropurino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 73276828 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 6-(2,3-dimethylphenyl)-4-methyl-4a,7,8,9a-tetrahydropurino[7,8-a]imidazole-1,3-dione |
| SMILES | Cc1cccc(N2CCN3C2=NC2C3C(=O)NC(=O)N2C)c1C |
| InChI | InChI=1S/C16H19N5O2/c1-9-5-4-6-11(10(9)2)20-7-8-21-12-13(17-15(20)21)19(3)16(23)18-14(12)22/h4-6,12-13H,7-8H2,1-3H3,(H,18,22,23) |
| InChIKey | IXWPGNGOZRYHJW-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |