C20H25N5O4 — CID 73276820
ethyl 2-[6-(2,3-dimethylphenyl)-4-methyl-1,3-dioxo-4a,7,8,9a-tetrahydropurino[7,8-a]imidazol-2-yl]acetate (PubChem CID 73276820) has the molecular formula C20H25N5O4 and a molecular weight of 399.45 g/mol. Its IUPAC name is ethyl 2-[6-(2,3-dimethylphenyl)-4-methyl-1,3-dioxo-4a,7,8,9a-tetrahydropurino[7,8-a]imidazol-2-yl]acetate.
| Compound Name | ethyl 2-[6-(2,3-dimethylphenyl)-4-methyl-1,3-dioxo-4a,7,8,9a-tetrahydropurino[7,8-a]imidazol-2-yl]acetate |
|---|---|
| PubChem CID | 73276820 |
| Molecular Formula | C20H25N5O4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | ethyl 2-[6-(2,3-dimethylphenyl)-4-methyl-1,3-dioxo-4a,7,8,9a-tetrahydropurino[7,8-a]imidazol-2-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)C2C(N=C3N(c4cccc(C)c4C)CCN32)N(C)C1=O |
| InChI | InChI=1S/C20H25N5O4/c1-5-29-15(26)11-25-18(27)16-17(22(4)20(25)28)21-19-23(9-10-24(16)19)14-8-6-7-12(2)13(14)3/h6-8,16-17H,5,9-11H2,1-4H3 |
| InChIKey | HBLOCHKUKUQQJM-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 85.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |