C15H16N4O2 — CID 54112153
1-(2,3-dimethylphenyl)-4-(1H-imidazol-5-yl)piperazine-2,3-dione (PubChem CID 54112153) has the molecular formula C15H16N4O2 and a molecular weight of 284.32 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-4-(1H-imidazol-5-yl)piperazine-2,3-dione.
| Compound Name | 1-(2,3-dimethylphenyl)-4-(1H-imidazol-5-yl)piperazine-2,3-dione |
|---|---|
| PubChem CID | 54112153 |
| Molecular Formula | C15H16N4O2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-4-(1H-imidazol-5-yl)piperazine-2,3-dione |
| SMILES | Cc1cccc(N2CCN(c3cnc[nH]3)C(=O)C2=O)c1C |
| InChI | InChI=1S/C15H16N4O2/c1-10-4-3-5-12(11(10)2)18-6-7-19(15(21)14(18)20)13-8-16-9-17-13/h3-5,8-9H,6-7H2,1-2H3,(H,16,17) |
| InChIKey | NHWDWWLZQVCRPO-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|