C12H12N4O — CID 135709705
5-amino-4-(2,3-dihydroindol-1-yl)-1H-pyrimidin-6-one (PubChem CID 135709705) has the molecular formula C12H12N4O and a molecular weight of 228.26 g/mol. Its IUPAC name is 5-amino-4-(2,3-dihydroindol-1-yl)-1H-pyrimidin-6-one.
| Compound Name | 5-amino-4-(2,3-dihydroindol-1-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135709705 |
| Molecular Formula | C12H12N4O |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 5-amino-4-(2,3-dihydroindol-1-yl)-1H-pyrimidin-6-one |
| SMILES | Nc1c(N2CCc3ccccc32)nc[nH]c1=O |
| InChI | InChI=1S/C12H12N4O/c13-10-11(14-7-15-12(10)17)16-6-5-8-3-1-2-4-9(8)16/h1-4,7H,5-6,13H2,(H,14,15,17) |
| InChIKey | AXQGMTDBKGESQO-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |