C14H14N4O3 — CID 135819103
5-nitro-4-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)-1H-pyrimidin-6-one (PubChem CID 135819103) has the molecular formula C14H14N4O3 and a molecular weight of 286.29 g/mol. Its IUPAC name is 5-nitro-4-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)-1H-pyrimidin-6-one.
| Compound Name | 5-nitro-4-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135819103 |
| Molecular Formula | C14H14N4O3 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 5-nitro-4-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(N2CCc3ccccc3CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H14N4O3/c19-14-12(18(20)21)13(15-9-16-14)17-7-5-10-3-1-2-4-11(10)6-8-17/h1-4,9H,5-8H2,(H,15,16,19) |
| InChIKey | QBMRZAWQUSEHEO-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 92.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|