C17H16N2 — CID 70171146
1-(1H-indol-2-yl)-3,4-dihydro-2H-quinoline (PubChem CID 70171146) has the molecular formula C17H16N2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 1-(1H-indol-2-yl)-3,4-dihydro-2H-quinoline.
| Compound Name | 1-(1H-indol-2-yl)-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 70171146 |
| Molecular Formula | C17H16N2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 1-(1H-indol-2-yl)-3,4-dihydro-2H-quinoline |
| SMILES | c1ccc2c(c1)CCCN2c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C17H16N2/c1-3-9-15-14(7-1)12-17(18-15)19-11-5-8-13-6-2-4-10-16(13)19/h1-4,6-7,9-10,12,18H,5,8,11H2 |
| InChIKey | VPHMINUTGPAYAG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |