C12H10N2O2 — CID 163731271
1-(1H-indol-2-yl)pyrrolidine-2,5-dione (PubChem CID 163731271) has the molecular formula C12H10N2O2 and a molecular weight of 214.22 g/mol. Its IUPAC name is 1-(1H-indol-2-yl)pyrrolidine-2,5-dione.
| Compound Name | 1-(1H-indol-2-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 163731271 |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 1-(1H-indol-2-yl)pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C12H10N2O2/c15-11-5-6-12(16)14(11)10-7-8-3-1-2-4-9(8)13-10/h1-4,7,13H,5-6H2 |
| InChIKey | KZTFCDBIDIQVSI-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|