C39H36N3O5S+ — CID 58729563
[9-[2-(4-carboxypiperidin-1-yl)sulfonylphenyl]-6-(N-methylanilino)xanthen-3-ylidene]-methyl-phenylazanium (PubChem CID 58729563) has the molecular formula C39H36N3O5S+ and a molecular weight of 658.80 g/mol. Its IUPAC name is [9-[2-(4-carboxypiperidin-1-yl)sulfonylphenyl]-6-(N-methylanilino)xanthen-3-ylidene]-methyl-phenylazanium.
| Compound Name | [9-[2-(4-carboxypiperidin-1-yl)sulfonylphenyl]-6-(N-methylanilino)xanthen-3-ylidene]-methyl-phenylazanium |
|---|---|
| PubChem CID | 58729563 |
| Molecular Formula | C39H36N3O5S+ |
| Molecular Weight | 658.80 g/mol |
| Exact Mass | 658.24 |
| IUPAC Name | [9-[2-(4-carboxypiperidin-1-yl)sulfonylphenyl]-6-(N-methylanilino)xanthen-3-ylidene]-methyl-phenylazanium |
| SMILES | CN(c1ccccc1)c1ccc2c(-c3ccccc3S(=O)(=O)N3CCC(C(=O)O)CC3)c3cc/c(=[N+](\C)c4ccccc4)cc-3oc2c1 |
| InChI | InChI=1S/C39H35N3O5S/c1-40(28-11-5-3-6-12-28)30-17-19-32-35(25-30)47-36-26-31(41(2)29-13-7-4-8-14-29)18-20-33(36)38(32)34-15-9-10-16-37(34)48(45,46)42-23-21-27(22-24-42)39(43)44/h3-20,25-27H,21-24H2,1-2H3/p+1 |
| InChIKey | ZKUNWFUKMCTLGR-UHFFFAOYSA-O |
| XLogP | 7.19 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.80 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|