C25H22NO4+ — CID 132537744
2-(3-methoxy-6-pyrrolidin-1-ium-1-ylidenexanthen-9-yl)benzoic acid (PubChem CID 132537744) has the molecular formula C25H22NO4+ and a molecular weight of 400.45 g/mol. Its IUPAC name is 2-(3-methoxy-6-pyrrolidin-1-ium-1-ylidenexanthen-9-yl)benzoic acid.
| Compound Name | 2-(3-methoxy-6-pyrrolidin-1-ium-1-ylidenexanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 132537744 |
| Molecular Formula | C25H22NO4+ |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 2-(3-methoxy-6-pyrrolidin-1-ium-1-ylidenexanthen-9-yl)benzoic acid |
| SMILES | COc1ccc2c(-c3ccccc3C(=O)O)c3ccc(=[N+]4CCCC4)cc-3oc2c1 |
| InChI | InChI=1S/C25H21NO4/c1-29-17-9-11-21-23(15-17)30-22-14-16(26-12-4-5-13-26)8-10-20(22)24(21)18-6-2-3-7-19(18)25(27)28/h2-3,6-11,14-15H,4-5,12-13H2,1H3/p+1 |
| InChIKey | JZWIKNSMMSABHX-UHFFFAOYSA-O |
| XLogP | 4.48 |
| TPSA | 62.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|