C36H42N3O4+ — CID 135141637
2-[[2-[3-(diethylamino)-6-piperidin-1-ium-1-ylidenexanthen-9-yl]benzoyl]-methylamino]ethyl 2-methylprop-2-enoate (PubChem CID 135141637) has the molecular formula C36H42N3O4+ and a molecular weight of 580.75 g/mol. Its IUPAC name is 2-[[2-[3-(diethylamino)-6-piperidin-1-ium-1-ylidenexanthen-9-yl]benzoyl]-methylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[2-[3-(diethylamino)-6-piperidin-1-ium-1-ylidenexanthen-9-yl]benzoyl]-methylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 135141637 |
| Molecular Formula | C36H42N3O4+ |
| Molecular Weight | 580.75 g/mol |
| Exact Mass | 580.32 |
| IUPAC Name | 2-[[2-[3-(diethylamino)-6-piperidin-1-ium-1-ylidenexanthen-9-yl]benzoyl]-methylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCN(C)C(=O)c1ccccc1-c1c2ccc(=[N+]3CCCCC3)cc-2oc2cc(N(CC)CC)ccc12 |
| InChI | InChI=1S/C36H42N3O4/c1-6-38(7-2)26-15-17-30-32(23-26)43-33-24-27(39-19-11-8-12-20-39)16-18-31(33)34(30)28-13-9-10-14-29(28)35(40)37(5)21-22-42-36(41)25(3)4/h9-10,13-18,23-24H,3,6-8,11-12,19-22H2,1-2,4-5H3/q+1 |
| InChIKey | JVWXNYWZIUXFRS-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.75 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|