C23H27N2O2+ — CID 170787518
1-(3-pyrrolidin-1-ium-1-ylidene-6-pyrrolidin-1-ylxanthen-9-yl)ethanol (PubChem CID 170787518) has the molecular formula C23H27N2O2+ and a molecular weight of 363.48 g/mol. Its IUPAC name is 1-(3-pyrrolidin-1-ium-1-ylidene-6-pyrrolidin-1-ylxanthen-9-yl)ethanol.
| Compound Name | 1-(3-pyrrolidin-1-ium-1-ylidene-6-pyrrolidin-1-ylxanthen-9-yl)ethanol |
|---|---|
| PubChem CID | 170787518 |
| Molecular Formula | C23H27N2O2+ |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 1-(3-pyrrolidin-1-ium-1-ylidene-6-pyrrolidin-1-ylxanthen-9-yl)ethanol |
| SMILES | CC(O)c1c2ccc(=[N+]3CCCC3)cc-2oc2cc(N3CCCC3)ccc12 |
| InChI | InChI=1S/C23H27N2O2/c1-16(26)23-19-8-6-17(24-10-2-3-11-24)14-21(19)27-22-15-18(7-9-20(22)23)25-12-4-5-13-25/h6-9,14-16,26H,2-5,10-13H2,1H3/q+1 |
| InChIKey | WHVDYOSFLYIPNB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 39.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|