C27H19F4N2O5+ — CID 126598712
2-[3-(3,3-difluoroazetidin-1-ium-1-ylidene)-6-(3,3-difluoroazetidin-1-yl)xanthen-9-yl]terephthalic acid (PubChem CID 126598712) has the molecular formula C27H19F4N2O5+ and a molecular weight of 527.45 g/mol. Its IUPAC name is 2-[3-(3,3-difluoroazetidin-1-ium-1-ylidene)-6-(3,3-difluoroazetidin-1-yl)xanthen-9-yl]terephthalic acid.
| Compound Name | 2-[3-(3,3-difluoroazetidin-1-ium-1-ylidene)-6-(3,3-difluoroazetidin-1-yl)xanthen-9-yl]terephthalic acid |
|---|---|
| PubChem CID | 126598712 |
| Molecular Formula | C27H19F4N2O5+ |
| Molecular Weight | 527.45 g/mol |
| Exact Mass | 527.12 |
| IUPAC Name | 2-[3-(3,3-difluoroazetidin-1-ium-1-ylidene)-6-(3,3-difluoroazetidin-1-yl)xanthen-9-yl]terephthalic acid |
| SMILES | O=C(O)c1ccc(C(=O)O)c(-c2c3ccc(=[N+]4CC(F)(F)C4)cc-3oc3cc(N4CC(F)(F)C4)ccc23)c1 |
| InChI | InChI=1S/C27H18F4N2O5/c28-26(29)10-32(11-26)15-2-5-18-21(8-15)38-22-9-16(33-12-27(30,31)13-33)3-6-19(22)23(18)20-7-14(24(34)35)1-4-17(20)25(36)37/h1-9H,10-13H2,(H-,34,35,36,37)/p+1 |
| InChIKey | NEMQHPGUMYWUDT-UHFFFAOYSA-O |
| XLogP | 4.48 |
| TPSA | 93.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.45 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|