C29H27N2O6+ — CID 58341971
[9-[2-carboxy-5-(2-carboxypyrrolidine-1-carbonyl)phenyl]-6-methylxanthen-3-ylidene]-dimethylazanium (PubChem CID 58341971) has the molecular formula C29H27N2O6+ and a molecular weight of 499.54 g/mol. Its IUPAC name is [9-[2-carboxy-5-(2-carboxypyrrolidine-1-carbonyl)phenyl]-6-methylxanthen-3-ylidene]-dimethylazanium.
| Compound Name | [9-[2-carboxy-5-(2-carboxypyrrolidine-1-carbonyl)phenyl]-6-methylxanthen-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 58341971 |
| Molecular Formula | C29H27N2O6+ |
| Molecular Weight | 499.54 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | [9-[2-carboxy-5-(2-carboxypyrrolidine-1-carbonyl)phenyl]-6-methylxanthen-3-ylidene]-dimethylazanium |
| SMILES | Cc1ccc2c(-c3cc(C(=O)N4CCCC4C(=O)O)ccc3C(=O)O)c3ccc(=[N+](C)C)cc-3oc2c1 |
| InChI | InChI=1S/C29H26N2O6/c1-16-6-9-20-24(13-16)37-25-15-18(30(2)3)8-11-21(25)26(20)22-14-17(7-10-19(22)28(33)34)27(32)31-12-4-5-23(31)29(35)36/h6-11,13-15,23H,4-5,12H2,1-3H3,(H-,33,34,35,36)/p+1 |
| InChIKey | DLMUAXPKNXAIFU-UHFFFAOYSA-O |
| XLogP | 3.93 |
| TPSA | 111.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.54 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|