C47H52N5O7+ — CID 102112388
[9-[2-carboxy-5-[4-[7-(diethylamino)-2-oxochromene-3-carbonyl]piperazine-1-carbonyl]phenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium (PubChem CID 102112388) has the molecular formula C47H52N5O7+ and a molecular weight of 798.96 g/mol. Its IUPAC name is [9-[2-carboxy-5-[4-[7-(diethylamino)-2-oxochromene-3-carbonyl]piperazine-1-carbonyl]phenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium.
| Compound Name | [9-[2-carboxy-5-[4-[7-(diethylamino)-2-oxochromene-3-carbonyl]piperazine-1-carbonyl]phenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 102112388 |
| Molecular Formula | C47H52N5O7+ |
| Molecular Weight | 798.96 g/mol |
| Exact Mass | 798.39 |
| IUPAC Name | [9-[2-carboxy-5-[4-[7-(diethylamino)-2-oxochromene-3-carbonyl]piperazine-1-carbonyl]phenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium |
| SMILES | CCN(CC)c1ccc2cc(C(=O)N3CCN(C(=O)c4ccc(C(=O)O)c(-c5c6ccc(=[N+](CC)CC)cc-6oc6cc(N(CC)CC)ccc56)c4)CC3)c(=O)oc2c1 |
| InChI | InChI=1S/C47H51N5O7/c1-7-48(8-2)32-15-13-30-25-39(47(57)59-40(30)27-32)45(54)52-23-21-51(22-24-52)44(53)31-14-18-35(46(55)56)38(26-31)43-36-19-16-33(49(9-3)10-4)28-41(36)58-42-29-34(17-20-37(42)43)50(11-5)12-6/h13-20,25-29H,7-12,21-24H2,1-6H3/p+1 |
| InChIKey | HVJPJWNDTNZLJB-UHFFFAOYSA-O |
| XLogP | 7.11 |
| TPSA | 130.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.96 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|