C44H46N3O9S+ — CID 160580120
acetyloxymethyl 7-(ethanethioylamino)-2-oxochromene-3-carboxylate;[9-(2-carboxy-4-methylphenyl)-6-(diethylamino)xanthen-3-ylidene]-diethylazanium (PubChem CID 160580120) has the molecular formula C44H46N3O9S+ and a molecular weight of 792.93 g/mol. Its IUPAC name is acetyloxymethyl 7-(ethanethioylamino)-2-oxochromene-3-carboxylate;[9-(2-carboxy-4-methylphenyl)-6-(diethylamino)xanthen-3-ylidene]-diethylazanium.
| Compound Name | acetyloxymethyl 7-(ethanethioylamino)-2-oxochromene-3-carboxylate;[9-(2-carboxy-4-methylphenyl)-6-(diethylamino)xanthen-3-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 160580120 |
| Molecular Formula | C44H46N3O9S+ |
| Molecular Weight | 792.93 g/mol |
| Exact Mass | 792.29 |
| IUPAC Name | acetyloxymethyl 7-(ethanethioylamino)-2-oxochromene-3-carboxylate;[9-(2-carboxy-4-methylphenyl)-6-(diethylamino)xanthen-3-ylidene]-diethylazanium |
| SMILES | CC(=O)OCOC(=O)c1cc2ccc(NC(C)=S)cc2oc1=O.CCN(CC)c1ccc2c(-c3ccc(C)cc3C(=O)O)c3ccc(=[N+](CC)CC)cc-3oc2c1 |
| InChI | InChI=1S/C29H32N2O3.C15H13NO6S/c1-6-30(7-2)20-11-14-23-26(17-20)34-27-18-21(31(8-3)9-4)12-15-24(27)28(23)22-13-10-19(5)16-25(22)29(32)33;1-8(23)16-11-4-3-10-5-12(15(19)22-13(10)6-11)14(18)21-7-20-9(2)17/h10-18H,6-9H2,1-5H3;3-6H,7H2,1-2H3,(H,16,23)/p+1 |
| InChIKey | RBRBNLMEYHEUOG-UHFFFAOYSA-O |
| XLogP | 8.10 |
| TPSA | 151.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.93 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|