C43H43N4O8+ — CID 102112383
[9-[2-carboxy-4-[4-(7-hydroxy-2-oxochromene-3-carbonyl)piperazine-1-carbonyl]phenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium (PubChem CID 102112383) has the molecular formula C43H43N4O8+ and a molecular weight of 743.84 g/mol. Its IUPAC name is [9-[2-carboxy-4-[4-(7-hydroxy-2-oxochromene-3-carbonyl)piperazine-1-carbonyl]phenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium.
| Compound Name | [9-[2-carboxy-4-[4-(7-hydroxy-2-oxochromene-3-carbonyl)piperazine-1-carbonyl]phenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 102112383 |
| Molecular Formula | C43H43N4O8+ |
| Molecular Weight | 743.84 g/mol |
| Exact Mass | 743.31 |
| IUPAC Name | [9-[2-carboxy-4-[4-(7-hydroxy-2-oxochromene-3-carbonyl)piperazine-1-carbonyl]phenyl]-6-(diethylamino)xanthen-3-ylidene]-diethylazanium |
| SMILES | CCN(CC)c1ccc2c(-c3ccc(C(=O)N4CCN(C(=O)c5cc6ccc(O)cc6oc5=O)CC4)cc3C(=O)O)c3ccc(=[N+](CC)CC)cc-3oc2c1 |
| InChI | InChI=1S/C43H42N4O8/c1-5-44(6-2)28-11-15-32-37(23-28)54-38-24-29(45(7-3)8-4)12-16-33(38)39(32)31-14-10-27(22-34(31)42(51)52)40(49)46-17-19-47(20-18-46)41(50)35-21-26-9-13-30(48)25-36(26)55-43(35)53/h9-16,21-25H,5-8,17-20H2,1-4H3,(H-,48,50,51,52,53)/p+1 |
| InChIKey | RMHNFCYDNIZKGQ-UHFFFAOYSA-O |
| XLogP | 5.97 |
| TPSA | 147.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.84 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|