C34H32N4O8 — CID 11685948
2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]-4-[2-(2,5-dioxopyrrolidin-1-yl)oxycarbonylpyrrolidine-1-carbonyl]benzoate (PubChem CID 11685948) has the molecular formula C34H32N4O8 and a molecular weight of 624.65 g/mol. Its IUPAC name is 2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]-4-[2-(2,5-dioxopyrrolidin-1-yl)oxycarbonylpyrrolidine-1-carbonyl]benzoate.
| Compound Name | 2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]-4-[2-(2,5-dioxopyrrolidin-1-yl)oxycarbonylpyrrolidine-1-carbonyl]benzoate |
|---|---|
| PubChem CID | 11685948 |
| Molecular Formula | C34H32N4O8 |
| Molecular Weight | 624.65 g/mol |
| Exact Mass | 624.22 |
| IUPAC Name | 2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]-4-[2-(2,5-dioxopyrrolidin-1-yl)oxycarbonylpyrrolidine-1-carbonyl]benzoate |
| SMILES | CN(C)c1ccc2c(-c3cc(C(=O)N4CCCC4C(=O)ON4C(=O)CCC4=O)ccc3C(=O)[O-])c3ccc(=[N+](C)C)cc-3oc2c1 |
| InChI | InChI=1S/C34H32N4O8/c1-35(2)20-8-11-23-27(17-20)45-28-18-21(36(3)4)9-12-24(28)31(23)25-16-19(7-10-22(25)33(42)43)32(41)37-15-5-6-26(37)34(44)46-38-29(39)13-14-30(38)40/h7-12,16-18,26H,5-6,13-15H2,1-4H3 |
| InChIKey | FAKRMYLUKMWVNH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 143.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.65 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|