C31H28N5O6+ — CID 75628519
[9-[2-(2-diazoacetyl)-5-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]phenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium (PubChem CID 75628519) has the molecular formula C31H28N5O6+ and a molecular weight of 566.59 g/mol. Its IUPAC name is [9-[2-(2-diazoacetyl)-5-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]phenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium.
| Compound Name | [9-[2-(2-diazoacetyl)-5-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]phenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 75628519 |
| Molecular Formula | C31H28N5O6+ |
| Molecular Weight | 566.59 g/mol |
| Exact Mass | 566.20 |
| IUPAC Name | [9-[2-(2-diazoacetyl)-5-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]phenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium |
| SMILES | CN(C)c1ccc2c(-c3cc(CC(=O)ON4C(=O)CCC4=O)ccc3C(=O)C=[N+]=[N-])c3ccc(=[N+](C)C)cc-3oc2c1 |
| InChI | InChI=1S/C31H28N5O6/c1-34(2)19-6-9-22-26(15-19)41-27-16-20(35(3)4)7-10-23(27)31(22)24-13-18(5-8-21(24)25(37)17-33-32)14-30(40)42-36-28(38)11-12-29(36)39/h5-10,13,15-17H,11-12,14H2,1-4H3/q+1 |
| InChIKey | INVBHXDBAPFHJS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 136.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.59 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|