C32H29N3O8 — CID 58613129
2-[6-(dimethylamino)-3H-xanthen-9-yl]-4-[2-(2,5-dioxopyrrolidin-1-yl)oxycarbonylpyrrolidine-1-carbonyl]benzoic acid (PubChem CID 58613129) has the molecular formula C32H29N3O8 and a molecular weight of 583.60 g/mol. Its IUPAC name is 2-[6-(dimethylamino)-3H-xanthen-9-yl]-4-[2-(2,5-dioxopyrrolidin-1-yl)oxycarbonylpyrrolidine-1-carbonyl]benzoic acid.
| Compound Name | 2-[6-(dimethylamino)-3H-xanthen-9-yl]-4-[2-(2,5-dioxopyrrolidin-1-yl)oxycarbonylpyrrolidine-1-carbonyl]benzoic acid |
|---|---|
| PubChem CID | 58613129 |
| Molecular Formula | C32H29N3O8 |
| Molecular Weight | 583.60 g/mol |
| Exact Mass | 583.20 |
| IUPAC Name | 2-[6-(dimethylamino)-3H-xanthen-9-yl]-4-[2-(2,5-dioxopyrrolidin-1-yl)oxycarbonylpyrrolidine-1-carbonyl]benzoic acid |
| SMILES | CN(C)c1ccc2c(c1)OC1=CCC=CC1=C2c1cc(C(=O)N2CCCC2C(=O)ON2C(=O)CCC2=O)ccc1C(=O)O |
| InChI | InChI=1S/C32H29N3O8/c1-33(2)19-10-12-22-26(17-19)42-25-8-4-3-6-21(25)29(22)23-16-18(9-11-20(23)31(39)40)30(38)34-15-5-7-24(34)32(41)43-35-27(36)13-14-28(35)37/h3,6,8-12,16-17,24H,4-5,7,13-15H2,1-2H3,(H,39,40) |
| InChIKey | HZDWKTGOYIYSIE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 133.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.60 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|