C23H20N2O5 — CID 126748251
5-(2-aminoethylcarbamoyl)-2-(6-hydroxy-3H-xanthen-9-yl)benzoic acid (PubChem CID 126748251) has the molecular formula C23H20N2O5 and a molecular weight of 404.42 g/mol. Its IUPAC name is 5-(2-aminoethylcarbamoyl)-2-(6-hydroxy-3H-xanthen-9-yl)benzoic acid.
| Compound Name | 5-(2-aminoethylcarbamoyl)-2-(6-hydroxy-3H-xanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 126748251 |
| Molecular Formula | C23H20N2O5 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 5-(2-aminoethylcarbamoyl)-2-(6-hydroxy-3H-xanthen-9-yl)benzoic acid |
| SMILES | NCCNC(=O)c1ccc(C2=C3C=CCC=C3Oc3cc(O)ccc32)c(C(=O)O)c1 |
| InChI | InChI=1S/C23H20N2O5/c24-9-10-25-22(27)13-5-7-15(18(11-13)23(28)29)21-16-3-1-2-4-19(16)30-20-12-14(26)6-8-17(20)21/h1,3-8,11-12,26H,2,9-10,24H2,(H,25,27)(H,28,29) |
| InChIKey | ZEOPFLPUVYQZAZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |