C23H19NO6S — CID 177097736
2-(3,6-dihydroxy-9H-xanthen-9-yl)-5-(2-sulfanylethylcarbamoyl)benzoic acid (PubChem CID 177097736) has the molecular formula C23H19NO6S and a molecular weight of 437.47 g/mol. Its IUPAC name is 2-(3,6-dihydroxy-9H-xanthen-9-yl)-5-(2-sulfanylethylcarbamoyl)benzoic acid.
| Compound Name | 2-(3,6-dihydroxy-9H-xanthen-9-yl)-5-(2-sulfanylethylcarbamoyl)benzoic acid |
|---|---|
| PubChem CID | 177097736 |
| Molecular Formula | C23H19NO6S |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | 2-(3,6-dihydroxy-9H-xanthen-9-yl)-5-(2-sulfanylethylcarbamoyl)benzoic acid |
| SMILES | O=C(NCCS)c1ccc(C2c3ccc(O)cc3Oc3cc(O)ccc32)c(C(=O)O)c1 |
| InChI | InChI=1S/C23H19NO6S/c25-13-2-5-16-19(10-13)30-20-11-14(26)3-6-17(20)21(16)15-4-1-12(9-18(15)23(28)29)22(27)24-7-8-31/h1-6,9-11,21,25-26,31H,7-8H2,(H,24,27)(H,28,29) |
| InChIKey | RYYBFCLNDAOHKD-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|