C28H20BrNO6 — CID 91482302
3-[(2-bromo-2-phenylacetyl)amino]-2-(3,6-dihydroxy-9H-xanthen-9-yl)benzoic acid (PubChem CID 91482302) has the molecular formula C28H20BrNO6 and a molecular weight of 546.37 g/mol. Its IUPAC name is 3-[(2-bromo-2-phenylacetyl)amino]-2-(3,6-dihydroxy-9H-xanthen-9-yl)benzoic acid.
| Compound Name | 3-[(2-bromo-2-phenylacetyl)amino]-2-(3,6-dihydroxy-9H-xanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 91482302 |
| Molecular Formula | C28H20BrNO6 |
| Molecular Weight | 546.37 g/mol |
| Exact Mass | 545.05 |
| IUPAC Name | 3-[(2-bromo-2-phenylacetyl)amino]-2-(3,6-dihydroxy-9H-xanthen-9-yl)benzoic acid |
| SMILES | O=C(O)c1cccc(NC(=O)C(Br)c2ccccc2)c1C1c2ccc(O)cc2Oc2cc(O)ccc21 |
| InChI | InChI=1S/C28H20BrNO6/c29-26(15-5-2-1-3-6-15)27(33)30-21-8-4-7-20(28(34)35)25(21)24-18-11-9-16(31)13-22(18)36-23-14-17(32)10-12-19(23)24/h1-14,24,26,31-32H,(H,30,33)(H,34,35) |
| InChIKey | BDJGNJIMROVSBV-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.37 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|