C23H14Cl2N4O5 — CID 137191407
2-[1-amino-2-(5,6-dichlorotriazin-4-yl)-3,6-dihydroxy-9H-xanthen-9-yl]benzoic acid (PubChem CID 137191407) has the molecular formula C23H14Cl2N4O5 and a molecular weight of 497.29 g/mol. Its IUPAC name is 2-[1-amino-2-(5,6-dichlorotriazin-4-yl)-3,6-dihydroxy-9H-xanthen-9-yl]benzoic acid.
| Compound Name | 2-[1-amino-2-(5,6-dichlorotriazin-4-yl)-3,6-dihydroxy-9H-xanthen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 137191407 |
| Molecular Formula | C23H14Cl2N4O5 |
| Molecular Weight | 497.29 g/mol |
| Exact Mass | 496.03 |
| IUPAC Name | 2-[1-amino-2-(5,6-dichlorotriazin-4-yl)-3,6-dihydroxy-9H-xanthen-9-yl]benzoic acid |
| SMILES | Nc1c(-c2nnnc(Cl)c2Cl)c(O)cc2c1C(c1ccccc1C(=O)O)c1ccc(O)cc1O2 |
| InChI | InChI=1S/C23H14Cl2N4O5/c24-19-21(27-29-28-22(19)25)17-13(31)8-15-18(20(17)26)16(10-3-1-2-4-11(10)23(32)33)12-6-5-9(30)7-14(12)34-15/h1-8,16,30-31H,26H2,(H,32,33) |
| InChIKey | VASYSBCFOWBNEE-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 151.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.29 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|