C46H38Cl2N6O5 — CID 91442791
2-[4,5-bis(2-amino-1,3-dipyridin-2-ylpropan-2-yl)-2,7-dichloro-3,6-dihydroxy-9H-xanthen-9-yl]benzoic acid (PubChem CID 91442791) has the molecular formula C46H38Cl2N6O5 and a molecular weight of 825.75 g/mol. Its IUPAC name is 2-[4,5-bis(2-amino-1,3-dipyridin-2-ylpropan-2-yl)-2,7-dichloro-3,6-dihydroxy-9H-xanthen-9-yl]benzoic acid.
| Compound Name | 2-[4,5-bis(2-amino-1,3-dipyridin-2-ylpropan-2-yl)-2,7-dichloro-3,6-dihydroxy-9H-xanthen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 91442791 |
| Molecular Formula | C46H38Cl2N6O5 |
| Molecular Weight | 825.75 g/mol |
| Exact Mass | 824.23 |
| IUPAC Name | 2-[4,5-bis(2-amino-1,3-dipyridin-2-ylpropan-2-yl)-2,7-dichloro-3,6-dihydroxy-9H-xanthen-9-yl]benzoic acid |
| SMILES | NC(Cc1ccccn1)(Cc1ccccn1)c1c(O)c(Cl)cc2c1Oc1c(cc(Cl)c(O)c1C(N)(Cc1ccccn1)Cc1ccccn1)C2c1ccccc1C(=O)O |
| InChI | InChI=1S/C46H38Cl2N6O5/c47-35-21-33-37(31-15-1-2-16-32(31)44(57)58)34-22-36(48)41(56)39(46(50,25-29-13-5-9-19-53-29)26-30-14-6-10-20-54-30)43(34)59-42(33)38(40(35)55)45(49,23-27-11-3-7-17-51-27)24-28-12-4-8-18-52-28/h1-22,37,55-56H,23-26,49-50H2,(H,57,58) |
| InChIKey | VSWCCUXEFFPVQK-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 190.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.75 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|